C21H22N4O4S — CID 19376593
methyl 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoate (PubChem CID 19376593) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is methyl 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 19376593 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | methyl 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-n3cnc(CCC(=O)OC)c3)c(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C21H22N4O4S/c1-29-20(26)10-8-17-12-25(13-24-17)18-9-7-16(11-19(18)30(2,27)28)14-3-5-15(6-4-14)21(22)23/h3-7,9,11-13H,8,10H2,1-2H3,(H3,22,23) |
| InChIKey | YNUXGCGYBGNJOU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|