C20H20N4O4S — CID 19376556
3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoic acid (PubChem CID 19376556) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoic acid.
| Compound Name | 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 19376556 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[1-[4-(4-carbamimidoylphenyl)-2-methylsulfonylphenyl]imidazol-4-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-n3cnc(CCC(=O)O)c3)c(S(C)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-29(27,28)18-10-15(13-2-4-14(5-3-13)20(21)22)6-8-17(18)24-11-16(23-12-24)7-9-19(25)26/h2-6,8,10-12H,7,9H2,1H3,(H3,21,22)(H,25,26) |
| InChIKey | XIUGHQWJQPHGDX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|