C18H18N6O2 — CID 19376573
methyl 3-[1-[4-(5-carbamimidoylpyrimidin-2-yl)phenyl]imidazol-4-yl]propanoate (PubChem CID 19376573) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is methyl 3-[1-[4-(5-carbamimidoylpyrimidin-2-yl)phenyl]imidazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-(5-carbamimidoylpyrimidin-2-yl)phenyl]imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 19376573 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | methyl 3-[1-[4-(5-carbamimidoylpyrimidin-2-yl)phenyl]imidazol-4-yl]propanoate |
| SMILES | [H]/N=C(\N)c1cnc(-c2ccc(-n3cnc(CCC(=O)OC)c3)cc2)nc1 |
| InChI | InChI=1S/C18H18N6O2/c1-26-16(25)7-4-14-10-24(11-23-14)15-5-2-12(3-6-15)18-21-8-13(9-22-18)17(19)20/h2-3,5-6,8-11H,4,7H2,1H3,(H3,19,20) |
| InChIKey | OTYGAYUQUIKERX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|