C26H26N6O2 — CID 67880079
methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-(2-phenylethyl)imidazol-4-yl]propanoate (PubChem CID 67880079) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-(2-phenylethyl)imidazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-(2-phenylethyl)imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 67880079 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-(2-phenylethyl)imidazol-4-yl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-n3cc(CCC(=O)OC)nc3CCc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C26H26N6O2/c1-34-25(33)16-12-21-17-32(23(29-21)14-7-18-5-3-2-4-6-18)24-15-13-22(30-31-24)19-8-10-20(11-9-19)26(27)28/h2-6,8-11,13,15,17H,7,12,14,16H2,1H3,(H3,27,28) |
| InChIKey | BGYDTPOUGUSODM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|