C20H23N7O2 — CID 19376447
methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]imidazol-2-yl]-2-(dimethylamino)propanoate (PubChem CID 19376447) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]imidazol-2-yl]-2-(dimethylamino)propanoate.
| Compound Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]imidazol-2-yl]-2-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 19376447 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]imidazol-2-yl]-2-(dimethylamino)propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-n3ccnc3CC(C(=O)OC)N(C)C)nn2)cc1 |
| InChI | InChI=1S/C20H23N7O2/c1-26(2)16(20(28)29-3)12-18-23-10-11-27(18)17-9-8-15(24-25-17)13-4-6-14(7-5-13)19(21)22/h4-11,16H,12H2,1-3H3,(H3,21,22) |
| InChIKey | KIRBOPLKTFIWRM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|