C19H20N6O2 — CID 67813917
methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-methylimidazol-4-yl]propanoate (PubChem CID 67813917) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-methylimidazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-methylimidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 67813917 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 3-[1-[6-(4-carbamimidoylphenyl)pyridazin-3-yl]-2-methylimidazol-4-yl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-n3cc(CCC(=O)OC)nc3C)nn2)cc1 |
| InChI | InChI=1S/C19H20N6O2/c1-12-22-15(7-10-18(26)27-2)11-25(12)17-9-8-16(23-24-17)13-3-5-14(6-4-13)19(20)21/h3-6,8-9,11H,7,10H2,1-2H3,(H3,20,21) |
| InChIKey | BWQYXMCLBNAQNM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|