C20H26ClN5O5S — CID 22856466
methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoylpyrimidin-2-yl)phenoxy]methyl]-1-methylsulfonylpyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 22856466) has the molecular formula C20H26ClN5O5S and a molecular weight of 483.98 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoylpyrimidin-2-yl)phenoxy]methyl]-1-methylsulfonylpyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoylpyrimidin-2-yl)phenoxy]methyl]-1-methylsulfonylpyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22856466 |
| Molecular Formula | C20H26ClN5O5S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoylpyrimidin-2-yl)phenoxy]methyl]-1-methylsulfonylpyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cnc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)CN3S(C)(=O)=O)cc2)nc1 |
| InChI | InChI=1S/C20H25N5O5S.ClH/c1-29-18(26)8-13-7-16(25(11-13)31(2,27)28)12-30-17-5-3-14(4-6-17)20-23-9-15(10-24-20)19(21)22;/h3-6,9-10,13,16H,7-8,11-12H2,1-2H3,(H3,21,22);1H/t13-,16-;/m0./s1 |
| InChIKey | MKASYPGHIGQOGY-LINSIKMZSA-N |
| XLogP | 1.44 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|