C22H29N5O5S — CID 22856432
methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-2-pyridinyl)phenoxy]methyl]-1-(dimethylsulfamoyl)pyrrolidin-3-yl]acetate (PubChem CID 22856432) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-2-pyridinyl)phenoxy]methyl]-1-(dimethylsulfamoyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-2-pyridinyl)phenoxy]methyl]-1-(dimethylsulfamoyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22856432 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-2-pyridinyl)phenoxy]methyl]-1-(dimethylsulfamoyl)pyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)CN3S(=O)(=O)N(C)C)cc2)nc1 |
| InChI | InChI=1S/C22H29N5O5S/c1-26(2)33(29,30)27-13-15(11-21(28)31-3)10-18(27)14-32-19-7-4-16(5-8-19)20-9-6-17(12-25-20)22(23)24/h4-9,12,15,18H,10-11,13-14H2,1-3H3,(H3,23,24)/t15-,18-/m0/s1 |
| InChIKey | PKFHIKQYNKYCKW-YJBOKZPZSA-N |
| XLogP | 1.47 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|