C24H26ClN3O6 — CID 22868639
methyl 2-[(5S,7S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-4-methoxy-1,2-dioxo-4-azaspiro[2.4]heptan-7-yl]acetate;hydrochloride (PubChem CID 22868639) has the molecular formula C24H26ClN3O6 and a molecular weight of 487.94 g/mol. Its IUPAC name is methyl 2-[(5S,7S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-4-methoxy-1,2-dioxo-4-azaspiro[2.4]heptan-7-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[(5S,7S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-4-methoxy-1,2-dioxo-4-azaspiro[2.4]heptan-7-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22868639 |
| Molecular Formula | C24H26ClN3O6 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 2-[(5S,7S)-5-[[4-(4-carbamimidoylphenyl)phenoxy]methyl]-4-methoxy-1,2-dioxo-4-azaspiro[2.4]heptan-7-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C4(C(=O)C4=O)N3OC)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O6.ClH/c1-31-20(28)12-17-11-18(27(32-2)24(17)21(29)22(24)30)13-33-19-9-7-15(8-10-19)14-3-5-16(6-4-14)23(25)26;/h3-10,17-18H,11-13H2,1-2H3,(H3,25,26);1H/t17-,18-;/m0./s1 |
| InChIKey | JOBWBRVDTYZCEE-APTPAJQOSA-N |
| XLogP | 2.14 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|