About 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid
3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid (PubChem CID 19376448) has the molecular formula C20H19N3O2S
and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid |
| PubChem CID | 19376448 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-c3nc(CCC(=O)O)sc3C)cc2)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-12-19(23-17(26-12)10-11-18(24)25)15-6-2-13(3-7-15)14-4-8-16(9-5-14)20(21)22/h2-9H,10-11H2,1H3,(H3,21,22)(H,24,25) |
| InChIKey | RGKNDWJCROPLKO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid?
The IUPAC name of 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid (CID 19376448) is 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid?
The canonical SMILES for 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid is [H]/N=C(\N)c1ccc(-c2ccc(-c3nc(CCC(=O)O)sc3C)cc2)cc1.
What is the InChIKey of 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid?
The InChIKey is RGKNDWJCROPLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2S/c1-12-19(23-17(26-12)10-11-18(24)25)15-6-2-13(3-7-15)14-4-8-16(9-5-14)20(21)22/h2-9H,10-11H2,1H3,(H3,21,22)(H,24,25).
What are the key properties of 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid?
3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid has a molecular weight of 365.46 g/mol, XLogP of 4.09, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(4-carbamimidoylphenyl)phenyl]-5-methyl-1,3-thiazol-2-yl]propanoic acid is sourced from PubChem (CID 19376448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).