C19H17N3O2S — CID 19376363
3-[2-[4-(4-carbamimidoylphenyl)phenyl]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 19376363) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[2-[4-(4-carbamimidoylphenyl)phenyl]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(4-carbamimidoylphenyl)phenyl]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 19376363 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-[2-[4-(4-carbamimidoylphenyl)phenyl]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(-c3nc(CCC(=O)O)cs3)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O2S/c20-18(21)14-5-1-12(2-6-14)13-3-7-15(8-4-13)19-22-16(11-25-19)9-10-17(23)24/h1-8,11H,9-10H2,(H3,20,21)(H,23,24) |
| InChIKey | ASGQITPBMNIIRB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|