C13H11F2NO3S — CID 103485230
3-[2-[4-(difluoromethoxy)phenyl]-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485230) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-[2-[4-(difluoromethoxy)phenyl]-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(difluoromethoxy)phenyl]-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103485230 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[2-[4-(difluoromethoxy)phenyl]-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(-c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C13H11F2NO3S/c14-13(15)19-10-4-1-8(2-5-10)12-16-9(7-20-12)3-6-11(17)18/h1-2,4-5,7,13H,3,6H2,(H,17,18) |
| InChIKey | MGECXPXITSYXRU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |