C12H10FNO3S — CID 79357223
2-fluoro-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetic acid (PubChem CID 79357223) has the molecular formula C12H10FNO3S and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-fluoro-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetic acid.
| Compound Name | 2-fluoro-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 79357223 |
| Molecular Formula | C12H10FNO3S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-fluoro-2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetic acid |
| SMILES | Cc1csc(-c2ccc(OC(F)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C12H10FNO3S/c1-7-6-18-11(14-7)8-2-4-9(5-3-8)17-10(13)12(15)16/h2-6,10H,1H3,(H,15,16) |
| InChIKey | RVBCAFKEDUUALD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |