C10H8BrNO2S2 — CID 103485307
3-[2-(5-bromothiophen-2-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485307) has the molecular formula C10H8BrNO2S2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-[2-(5-bromothiophen-2-yl)-1,3-thiazol-4-yl]propanoic acid.
| Compound Name | 3-[2-(5-bromothiophen-2-yl)-1,3-thiazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 103485307 |
| Molecular Formula | C10H8BrNO2S2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 3-[2-(5-bromothiophen-2-yl)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CCc1csc(-c2ccc(Br)s2)n1 |
| InChI | InChI=1S/C10H8BrNO2S2/c11-8-3-2-7(16-8)10-12-6(5-15-10)1-4-9(13)14/h2-3,5H,1,4H2,(H,13,14) |
| InChIKey | KXRMRXZMRXUPDV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |