C10H11NOS2 — CID 115089075
2-[2-(5-methylthiophen-2-yl)-1,3-thiazol-4-yl]ethanol (PubChem CID 115089075) has the molecular formula C10H11NOS2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-[2-(5-methylthiophen-2-yl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 2-[2-(5-methylthiophen-2-yl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 115089075 |
| Molecular Formula | C10H11NOS2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 2-[2-(5-methylthiophen-2-yl)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1ccc(-c2nc(CCO)cs2)s1 |
| InChI | InChI=1S/C10H11NOS2/c1-7-2-3-9(14-7)10-11-8(4-5-12)6-13-10/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | BSCFVXDRPSUNEM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |