About 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid
3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485287) has the molecular formula C12H13NO2S2
and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid |
| PubChem CID | 103485287 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid |
| SMILES | Cc1cc(-c2nc(CCC(=O)O)cs2)c(C)s1 |
| InChI | InChI=1S/C12H13NO2S2/c1-7-5-10(8(2)17-7)12-13-9(6-16-12)3-4-11(14)15/h5-6H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | RJOFELYKAGODEQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid (CID 103485287) is 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid is Cc1cc(-c2nc(CCC(=O)O)cs2)c(C)s1.
What is the InChIKey of 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is RJOFELYKAGODEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S2/c1-7-5-10(8(2)17-7)12-13-9(6-16-12)3-4-11(14)15/h5-6H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid?
3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 267.37 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,5-dimethylthiophen-3-yl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 103485287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).