3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid

C11H11N3O3S — CID 103485597

IUPAC3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid
SMILESCOc1cc(-c2nc(CCC(=O)O)cs2)ncn1
InChIInChI=1S/C11H11N3O3S/c1-17-9-4-8(12-6-13-9)11-14-7(5-18-11)2-3-10(15)16/h4-6H,2-3H2,1H3,(H,15,16)
InChIKeyFLKFTLDTXGNOQE-UHFFFAOYSA-N
MW265.29 g/mol
LogP1.63
Rot. Bonds5

About 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid

3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid (PubChem CID 103485597) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid
PubChem CID103485597
Molecular FormulaC11H11N3O3S
Molecular Weight265.29 g/mol
Exact Mass265.05
IUPAC Name3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid
SMILESCOc1cc(-c2nc(CCC(=O)O)cs2)ncn1
InChIInChI=1S/C11H11N3O3S/c1-17-9-4-8(12-6-13-9)11-14-7(5-18-11)2-3-10(15)16/h4-6H,2-3H2,1H3,(H,15,16)
InChIKeyFLKFTLDTXGNOQE-UHFFFAOYSA-N
XLogP1.63
TPSA85.20 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.29
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid (CID 103485597) is 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid is COc1cc(-c2nc(CCC(=O)O)cs2)ncn1.
What is the InChIKey of 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is FLKFTLDTXGNOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3S/c1-17-9-4-8(12-6-13-9)11-14-7(5-18-11)2-3-10(15)16/h4-6H,2-3H2,1H3,(H,15,16).
What are the key properties of 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid?
3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 265.29 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 103485597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).