C9H9N3O2S — CID 102953130
[2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]methanol (PubChem CID 102953130) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is [2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 102953130 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | [2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-yl]methanol |
| SMILES | COc1cc(-c2nc(CO)cs2)ncn1 |
| InChI | InChI=1S/C9H9N3O2S/c1-14-8-2-7(10-5-11-8)9-12-6(3-13)4-15-9/h2,4-5,13H,3H2,1H3 |
| InChIKey | ODXPEPAMUOWYKE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |