C8H7N3O2S — CID 130501534
2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-ol (PubChem CID 130501534) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-ol.
| Compound Name | 2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 130501534 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-(6-methoxypyrimidin-4-yl)-1,3-thiazol-4-ol |
| SMILES | COc1cc(-c2nc(O)cs2)ncn1 |
| InChI | InChI=1S/C8H7N3O2S/c1-13-7-2-5(9-4-10-7)8-11-6(12)3-14-8/h2-4,12H,1H3 |
| InChIKey | FGONMCKJGVTADC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |