C23H23ClN2O5 — CID 19376619
methyl 2-[4-(4-carbamimidoylphenyl)phenyl]-5-(3-methoxy-3-oxopropyl)furan-3-carboxylate;hydrochloride (PubChem CID 19376619) has the molecular formula C23H23ClN2O5 and a molecular weight of 442.90 g/mol. Its IUPAC name is methyl 2-[4-(4-carbamimidoylphenyl)phenyl]-5-(3-methoxy-3-oxopropyl)furan-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-[4-(4-carbamimidoylphenyl)phenyl]-5-(3-methoxy-3-oxopropyl)furan-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 19376619 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | methyl 2-[4-(4-carbamimidoylphenyl)phenyl]-5-(3-methoxy-3-oxopropyl)furan-3-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(-c3oc(CCC(=O)OC)cc3C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C23H22N2O5.ClH/c1-28-20(26)12-11-18-13-19(23(27)29-2)21(30-18)16-7-3-14(4-8-16)15-5-9-17(10-6-15)22(24)25;/h3-10,13H,11-12H2,1-2H3,(H3,24,25);1H |
| InChIKey | ONEXWXOXTBCATI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|