C26H30ClN3O5S — CID 67576903
methyl 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoate;hydrochloride (PubChem CID 67576903) has the molecular formula C26H30ClN3O5S and a molecular weight of 532.06 g/mol. Its IUPAC name is methyl 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoate;hydrochloride.
| Compound Name | methyl 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 67576903 |
| Molecular Formula | C26H30ClN3O5S |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | methyl 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OCCCCCC(=O)OC)c(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H29N3O5S.ClH/c1-33-25(30)10-6-3-7-17-34-24-16-15-21(19-11-13-20(14-12-19)26(27)28)18-23(24)29-35(31,32)22-8-4-2-5-9-22;/h2,4-5,8-9,11-16,18,29H,3,6-7,10,17H2,1H3,(H3,27,28);1H |
| InChIKey | LMVDCXXWKLNVJZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|