C25H27N3O5S — CID 54350354
6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoic acid (PubChem CID 54350354) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoic acid.
| Compound Name | 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 54350354 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 6-[2-(benzenesulfonamido)-4-(4-carbamimidoylphenyl)phenoxy]hexanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OCCCCCC(=O)O)c(NS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H27N3O5S/c26-25(27)19-12-10-18(11-13-19)20-14-15-23(33-16-6-2-5-9-24(29)30)22(17-20)28-34(31,32)21-7-3-1-4-8-21/h1,3-4,7-8,10-15,17,28H,2,5-6,9,16H2,(H3,26,27)(H,29,30) |
| InChIKey | UFHAWJBJWZGSSK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|