C33H32ClN3O5S — CID 10232740
methyl 6-[6-[(4-chlorophenyl)sulfonylamino]-3-(4-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 10232740) has the molecular formula C33H32ClN3O5S and a molecular weight of 618.16 g/mol. Its IUPAC name is methyl 6-[6-[(4-chlorophenyl)sulfonylamino]-3-(4-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[6-[(4-chlorophenyl)sulfonylamino]-3-(4-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10232740 |
| Molecular Formula | C33H32ClN3O5S |
| Molecular Weight | 618.16 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | methyl 6-[6-[(4-chlorophenyl)sulfonylamino]-3-(4-methylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1cc2c(cc1NS(=O)(=O)c1ccc(Cl)cc1)nc(-c1ccccc1)n2-c1ccc(C)cc1 |
| InChI | InChI=1S/C33H32ClN3O5S/c1-23-12-16-26(17-13-23)37-30-22-31(42-20-8-4-7-11-32(38)41-2)29(36-43(39,40)27-18-14-25(34)15-19-27)21-28(30)35-33(37)24-9-5-3-6-10-24/h3,5-6,9-10,12-19,21-22,36H,4,7-8,11,20H2,1-2H3 |
| InChIKey | ZVPCRULTTFWXTG-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.16 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|