C28H22ClN3O4S — CID 69105305
methyl 2-[(4-chlorophenyl)sulfonyl-(1,2-diphenylbenzimidazol-5-yl)amino]acetate (PubChem CID 69105305) has the molecular formula C28H22ClN3O4S and a molecular weight of 532.02 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)sulfonyl-(1,2-diphenylbenzimidazol-5-yl)amino]acetate.
| Compound Name | methyl 2-[(4-chlorophenyl)sulfonyl-(1,2-diphenylbenzimidazol-5-yl)amino]acetate |
|---|---|
| PubChem CID | 69105305 |
| Molecular Formula | C28H22ClN3O4S |
| Molecular Weight | 532.02 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)sulfonyl-(1,2-diphenylbenzimidazol-5-yl)amino]acetate |
| SMILES | COC(=O)CN(c1ccc2c(c1)nc(-c1ccccc1)n2-c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H22ClN3O4S/c1-36-27(33)19-31(37(34,35)24-15-12-21(29)13-16-24)23-14-17-26-25(18-23)30-28(20-8-4-2-5-9-20)32(26)22-10-6-3-7-11-22/h2-18H,19H2,1H3 |
| InChIKey | SMQUCTQDKBUQKV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.02 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |