C27H26N2O4 — CID 54357078
methyl 6-[2-benzamido-4-(4-cyanophenyl)phenoxy]hexanoate (PubChem CID 54357078) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is methyl 6-[2-benzamido-4-(4-cyanophenyl)phenoxy]hexanoate.
| Compound Name | methyl 6-[2-benzamido-4-(4-cyanophenyl)phenoxy]hexanoate |
|---|---|
| PubChem CID | 54357078 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | methyl 6-[2-benzamido-4-(4-cyanophenyl)phenoxy]hexanoate |
| SMILES | COC(=O)CCCCCOc1ccc(-c2ccc(C#N)cc2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c1-32-26(30)10-6-3-7-17-33-25-16-15-23(21-13-11-20(19-28)12-14-21)18-24(25)29-27(31)22-8-4-2-5-9-22/h2,4-5,8-9,11-16,18H,3,6-7,10,17H2,1H3,(H,29,31) |
| InChIKey | UJVNSUCQWBQKHL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|