About methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride
methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride (PubChem CID 67576291) has the molecular formula C20H24ClFN2O3
and a molecular weight of 394.87 g/mol. Its IUPAC name is methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride |
| PubChem CID | 67576291 |
| Molecular Formula | C20H24ClFN2O3 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(OCCCCCC(=O)OC)cc2)cc1F |
| InChI | InChI=1S/C20H23FN2O3.ClH/c1-25-19(24)5-3-2-4-12-26-16-9-6-14(7-10-16)15-8-11-17(20(22)23)18(21)13-15;/h6-11,13H,2-5,12H2,1H3,(H3,22,23);1H |
| InChIKey | DWBCCYPZCRPINP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride?
The IUPAC name of methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride (CID 67576291) is methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride.
What is the SMILES notation for methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride?
The canonical SMILES for methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride is Cl.[H]/N=C(\N)c1ccc(-c2ccc(OCCCCCC(=O)OC)cc2)cc1F.
What is the InChIKey of methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride?
The InChIKey is DWBCCYPZCRPINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O3.ClH/c1-25-19(24)5-3-2-4-12-26-16-9-6-14(7-10-16)15-8-11-17(20(22)23)18(21)13-15;/h6-11,13H,2-5,12H2,1H3,(H3,22,23);1H.
What are the key properties of methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride?
methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride has a molecular weight of 394.87 g/mol, XLogP of 4.31, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]hexanoate;hydrochloride is sourced from PubChem (CID 67576291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).