C24H29FO3 — CID 139786123
2-fluoro-4-(4-undec-10-enoxyphenyl)benzoic acid (PubChem CID 139786123) has the molecular formula C24H29FO3 and a molecular weight of 384.49 g/mol. Its IUPAC name is 2-fluoro-4-(4-undec-10-enoxyphenyl)benzoic acid.
| Compound Name | 2-fluoro-4-(4-undec-10-enoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 139786123 |
| Molecular Formula | C24H29FO3 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-fluoro-4-(4-undec-10-enoxyphenyl)benzoic acid |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2ccc(C(=O)O)c(F)c2)cc1 |
| InChI | InChI=1S/C24H29FO3/c1-2-3-4-5-6-7-8-9-10-17-28-21-14-11-19(12-15-21)20-13-16-22(24(26)27)23(25)18-20/h2,11-16,18H,1,3-10,17H2,(H,26,27) |
| InChIKey | BVBWCQQTBIQMCJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|