C41H54O3 — CID 102474145
3,5-bis(4-undec-10-enoxyphenyl)benzaldehyde (PubChem CID 102474145) has the molecular formula C41H54O3 and a molecular weight of 594.88 g/mol. Its IUPAC name is 3,5-bis(4-undec-10-enoxyphenyl)benzaldehyde.
| Compound Name | 3,5-bis(4-undec-10-enoxyphenyl)benzaldehyde |
|---|---|
| PubChem CID | 102474145 |
| Molecular Formula | C41H54O3 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | 3,5-bis(4-undec-10-enoxyphenyl)benzaldehyde |
| SMILES | C=CCCCCCCCCCOc1ccc(-c2cc(C=O)cc(-c3ccc(OCCCCCCCCCC=C)cc3)c2)cc1 |
| InChI | InChI=1S/C41H54O3/c1-3-5-7-9-11-13-15-17-19-29-43-40-25-21-36(22-26-40)38-31-35(34-42)32-39(33-38)37-23-27-41(28-24-37)44-30-20-18-16-14-12-10-8-6-4-2/h3-4,21-28,31-34H,1-2,5-20,29-30H2 |
| InChIKey | LABMFDRWSAGBGZ-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|