C24H22N4O3 — CID 22098236
2-[3-[2-[4-(4-carbamimidoylphenyl)phenyl]ethyl]-2-oxobenzimidazol-1-yl]acetic acid (PubChem CID 22098236) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[3-[2-[4-(4-carbamimidoylphenyl)phenyl]ethyl]-2-oxobenzimidazol-1-yl]acetic acid.
| Compound Name | 2-[3-[2-[4-(4-carbamimidoylphenyl)phenyl]ethyl]-2-oxobenzimidazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 22098236 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[3-[2-[4-(4-carbamimidoylphenyl)phenyl]ethyl]-2-oxobenzimidazol-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(CCn3c(=O)n(CC(=O)O)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c25-23(26)19-11-9-18(10-12-19)17-7-5-16(6-8-17)13-14-27-20-3-1-2-4-21(20)28(24(27)31)15-22(29)30/h1-12H,13-15H2,(H3,25,26)(H,29,30) |
| InChIKey | XYYDIGVZFYLTQG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|