C27H33N5O3 — CID 23302645
4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexanecarbonyl(methyl)amino]benzimidazol-1-yl]butanoic acid (PubChem CID 23302645) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexanecarbonyl(methyl)amino]benzimidazol-1-yl]butanoic acid.
| Compound Name | 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexanecarbonyl(methyl)amino]benzimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 23302645 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 4-[2-[(4-carbamimidoylphenyl)methyl]-5-[cyclohexanecarbonyl(methyl)amino]benzimidazol-1-yl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(Cc2nc3cc(N(C)C(=O)C4CCCCC4)ccc3n2CCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H33N5O3/c1-31(27(35)20-6-3-2-4-7-20)21-13-14-23-22(17-21)30-24(32(23)15-5-8-25(33)34)16-18-9-11-19(12-10-18)26(28)29/h9-14,17,20H,2-8,15-16H2,1H3,(H3,28,29)(H,33,34) |
| InChIKey | FSFCPFNKQJMPNF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|