C31H33N3O2 — CID 58742961
N-methyl-N-[2-phenacyl-1-(2-phenylethyl)benzimidazol-5-yl]cyclohexanecarboxamide (PubChem CID 58742961) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-methyl-N-[2-phenacyl-1-(2-phenylethyl)benzimidazol-5-yl]cyclohexanecarboxamide.
| Compound Name | N-methyl-N-[2-phenacyl-1-(2-phenylethyl)benzimidazol-5-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 58742961 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-methyl-N-[2-phenacyl-1-(2-phenylethyl)benzimidazol-5-yl]cyclohexanecarboxamide |
| SMILES | CN(C(=O)C1CCCCC1)c1ccc2c(c1)nc(CC(=O)c1ccccc1)n2CCc1ccccc1 |
| InChI | InChI=1S/C31H33N3O2/c1-33(31(36)25-15-9-4-10-16-25)26-17-18-28-27(21-26)32-30(22-29(35)24-13-7-3-8-14-24)34(28)20-19-23-11-5-2-6-12-23/h2-3,5-8,11-14,17-18,21,25H,4,9-10,15-16,19-20,22H2,1H3 |
| InChIKey | LZIOVRQZXJWWMY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |