C24H29N3O — CID 16999536
N-cyclohexyl-N-methyl-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide (PubChem CID 16999536) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide.
| Compound Name | N-cyclohexyl-N-methyl-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 16999536 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-[2-(2-phenylethyl)benzimidazol-1-yl]acetamide |
| SMILES | CN(C(=O)Cn1c(CCc2ccccc2)nc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C24H29N3O/c1-26(20-12-6-3-7-13-20)24(28)18-27-22-15-9-8-14-21(22)25-23(27)17-16-19-10-4-2-5-11-19/h2,4-5,8-11,14-15,20H,3,6-7,12-13,16-18H2,1H3 |
| InChIKey | YKYLGSNZMSPMQE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |