C30H40N4O2 — CID 16981519
N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 16981519) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16981519 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C30H40N4O2/c1-30(2,3)29(36)31-20-12-19-27-32-25-17-10-11-18-26(25)34(27)22-28(35)33(24-15-8-5-9-16-24)21-23-13-6-4-7-14-23/h4,6-7,10-11,13-14,17-18,24H,5,8-9,12,15-16,19-22H2,1-3H3,(H,31,36) |
| InChIKey | OOYQRHZQSFRBRY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|