C34H39BrN4O2 — CID 16990704
N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-bromobenzamide (PubChem CID 16990704) has the molecular formula C34H39BrN4O2 and a molecular weight of 615.62 g/mol. Its IUPAC name is N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-bromobenzamide.
| Compound Name | N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 16990704 |
| Molecular Formula | C34H39BrN4O2 |
| Molecular Weight | 615.62 g/mol |
| Exact Mass | 614.23 |
| IUPAC Name | N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-bromobenzamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C34H39BrN4O2/c35-28-16-12-15-27(23-28)34(41)36-22-11-3-8-21-32-37-30-19-9-10-20-31(30)39(32)25-33(40)38(29-17-6-2-7-18-29)24-26-13-4-1-5-14-26/h1,4-5,9-10,12-16,19-20,23,29H,2-3,6-8,11,17-18,21-22,24-25H2,(H,36,41) |
| InChIKey | VAPROUYNRKLDKY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|