C29H38N4O2 — CID 16981235
N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide (PubChem CID 16981235) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide.
| Compound Name | N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide |
|---|---|
| PubChem CID | 16981235 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | N-[3-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]butanamide |
| SMILES | CCCC(=O)NCCCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H38N4O2/c1-2-12-28(34)30-20-11-19-27-31-25-17-9-10-18-26(25)33(27)22-29(35)32(24-15-7-4-8-16-24)21-23-13-5-3-6-14-23/h3,5-6,9-10,13-14,17-18,24H,2,4,7-8,11-12,15-16,19-22H2,1H3,(H,30,34) |
| InChIKey | AGYIZBFZVKRLJQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|