C27H32N4O2 — CID 16980340
N-[2-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]prop-2-enamide (PubChem CID 16980340) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[2-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 16980340 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | N-[2-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C27H32N4O2/c1-2-26(32)28-18-17-25-29-23-15-9-10-16-24(23)31(25)20-27(33)30(22-13-7-4-8-14-22)19-21-11-5-3-6-12-21/h2-3,5-6,9-12,15-16,22H,1,4,7-8,13-14,17-20H2,(H,28,32) |
| InChIKey | VOOZVDUXKYFJDA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|