C30H38N4O2 — CID 16992324
N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]prop-2-enamide (PubChem CID 16992324) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]prop-2-enamide.
| Compound Name | N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 16992324 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | N-[5-[1-[2-[benzyl(cyclohexyl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCCCc1nc2ccccc2n1CC(=O)N(Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C30H38N4O2/c1-2-29(35)31-21-13-5-10-20-28-32-26-18-11-12-19-27(26)34(28)23-30(36)33(25-16-8-4-9-17-25)22-24-14-6-3-7-15-24/h2-3,6-7,11-12,14-15,18-19,25H,1,4-5,8-10,13,16-17,20-23H2,(H,31,35) |
| InChIKey | PWXLYDZPBAJMPM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|