C30H44N4O2 — CID 16992179
(E)-N-[5-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]but-2-enamide (PubChem CID 16992179) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is (E)-N-[5-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]but-2-enamide.
| Compound Name | (E)-N-[5-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]but-2-enamide |
|---|---|
| PubChem CID | 16992179 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | (E)-N-[5-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCCCCc1nc2ccccc2n1CC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C30H44N4O2/c1-2-14-29(35)31-22-13-5-10-21-28-32-26-19-11-12-20-27(26)33(28)23-30(36)34(24-15-6-3-7-16-24)25-17-8-4-9-18-25/h2,11-12,14,19-20,24-25H,3-10,13,15-18,21-23H2,1H3,(H,31,35)/b14-2+ |
| InChIKey | BBQPRMJVXLHZSJ-JLZUIIAYSA-N |
| XLogP | 5.94 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|