C33H44N4O3 — CID 16985663
N-[3-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 16985663) has the molecular formula C33H44N4O3 and a molecular weight of 544.74 g/mol. Its IUPAC name is N-[3-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[3-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16985663 |
| Molecular Formula | C33H44N4O3 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | N-[3-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCc2nc3ccccc3n2CC(=O)N(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C33H44N4O3/c1-40-28-20-18-25(19-21-28)23-32(38)34-22-10-17-31-35-29-15-8-9-16-30(29)36(31)24-33(39)37(26-11-4-2-5-12-26)27-13-6-3-7-14-27/h8-9,15-16,18-21,26-27H,2-7,10-14,17,22-24H2,1H3,(H,34,38) |
| InChIKey | JLLCNMSFGIGPBS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|