C28H36N4O2S — CID 16975715
N-[2-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16975715) has the molecular formula C28H36N4O2S and a molecular weight of 492.69 g/mol. Its IUPAC name is N-[2-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16975715 |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-[2-[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1nc2ccccc2n1CC(=O)N(C1CCCCC1)C1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C28H36N4O2S/c33-27(32(21-10-3-1-4-11-21)22-12-5-2-6-13-22)20-31-24-15-8-7-14-23(24)30-26(31)17-18-29-28(34)25-16-9-19-35-25/h7-9,14-16,19,21-22H,1-6,10-13,17-18,20H2,(H,29,34) |
| InChIKey | SDSUFRGOIYYLDO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |