C29H35ClN4O2 — CID 17007564
2-chloro-N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17007564) has the molecular formula C29H35ClN4O2 and a molecular weight of 507.08 g/mol. Its IUPAC name is 2-chloro-N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17007564 |
| Molecular Formula | C29H35ClN4O2 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-chloro-N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc2ccccc2n1CC(=O)N(C1CCCCC1)C1CCCCC1)c1ccccc1Cl |
| InChI | InChI=1S/C29H35ClN4O2/c30-24-16-8-7-15-23(24)29(36)31-19-27-32-25-17-9-10-18-26(25)33(27)20-28(35)34(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h7-10,15-18,21-22H,1-6,11-14,19-20H2,(H,31,36) |
| InChIKey | USCNUGWEFRFDPV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |