C24H21ClN4O2 — CID 17007545
2-chloro-N-[[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17007545) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-chloro-N-[[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17007545 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-chloro-N-[[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | CN(C(=O)Cn1c(CNC(=O)c2ccccc2Cl)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24H21ClN4O2/c1-28(17-9-3-2-4-10-17)23(30)16-29-21-14-8-7-13-20(21)27-22(29)15-26-24(31)18-11-5-6-12-19(18)25/h2-14H,15-16H2,1H3,(H,26,31) |
| InChIKey | QZIMSXYHQVJFOM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |