C29H32N4O2 — CID 16989568
2-methyl-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16989568) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-methyl-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 2-methyl-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16989568 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-methyl-N-[5-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NCCCCCc1nc2ccccc2n1CC(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C29H32N4O2/c1-22-13-8-9-16-24(22)29(35)30-20-12-4-7-19-27-31-25-17-10-11-18-26(25)33(27)21-28(34)32(2)23-14-5-3-6-15-23/h3,5-6,8-11,13-18H,4,7,12,19-21H2,1-2H3,(H,30,35) |
| InChIKey | PAFXIWIICXLZPX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|