C28H35N5O2 — CID 16964062
N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 16964062) has the molecular formula C28H35N5O2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16964062 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2n1CC(=O)N(C1CCCCC1)C1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C28H35N5O2/c34-27(33(22-11-3-1-4-12-22)23-13-5-2-6-14-23)20-32-25-16-8-7-15-24(25)31-26(32)19-30-28(35)21-10-9-17-29-18-21/h7-10,15-18,22-23H,1-6,11-14,19-20H2,(H,30,35) |
| InChIKey | IUDMINQREZUAML-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |