C31H40N4O2 — CID 16970743
N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylpropanamide (PubChem CID 16970743) has the molecular formula C31H40N4O2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylpropanamide.
| Compound Name | N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 16970743 |
| Molecular Formula | C31H40N4O2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | N-[[1-[2-(dicyclohexylamino)-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCc1nc2ccccc2n1CC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C31H40N4O2/c36-30(21-20-24-12-4-1-5-13-24)32-22-29-33-27-18-10-11-19-28(27)34(29)23-31(37)35(25-14-6-2-7-15-25)26-16-8-3-9-17-26/h1,4-5,10-13,18-19,25-26H,2-3,6-9,14-17,20-23H2,(H,32,36) |
| InChIKey | BGZKDYOWWYFGTI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |