C23H30N4O2S — CID 16982163
N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide (PubChem CID 16982163) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16982163 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
| SMILES | CC(C)N(C(=O)Cn1c(CCCNC(=O)c2cccs2)nc2ccccc21)C(C)C |
| InChI | InChI=1S/C23H30N4O2S/c1-16(2)27(17(3)4)22(28)15-26-19-10-6-5-9-18(19)25-21(26)12-7-13-24-23(29)20-11-8-14-30-20/h5-6,8-11,14,16-17H,7,12-13,15H2,1-4H3,(H,24,29) |
| InChIKey | HZJKXVSAUJKBHS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|