C27H35FN4O2 — CID 16990047
N-[5-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide (PubChem CID 16990047) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[5-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide.
| Compound Name | N-[5-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 16990047 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | N-[5-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
| SMILES | CC(C)N(C(=O)Cn1c(CCCCCNC(=O)c2ccccc2F)nc2ccccc21)C(C)C |
| InChI | InChI=1S/C27H35FN4O2/c1-19(2)32(20(3)4)26(33)18-31-24-15-10-9-14-23(24)30-25(31)16-6-5-11-17-29-27(34)21-12-7-8-13-22(21)28/h7-10,12-15,19-20H,5-6,11,16-18H2,1-4H3,(H,29,34) |
| InChIKey | PDQBZNRCTQKWSI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|