C28H32N4O2S — CID 16994913
N-[5-[1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994913) has the molecular formula C28H32N4O2S and a molecular weight of 488.66 g/mol. Its IUPAC name is N-[5-[1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994913 |
| Molecular Formula | C28H32N4O2S |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[5-[1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | CC(C)N(C(=O)Cn1c(CCCCCNC(=O)c2cccs2)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O2S/c1-21(2)32(22-12-5-3-6-13-22)27(33)20-31-24-15-9-8-14-23(24)30-26(31)17-7-4-10-18-29-28(34)25-16-11-19-35-25/h3,5-6,8-9,11-16,19,21H,4,7,10,17-18,20H2,1-2H3,(H,29,34) |
| InChIKey | RIWCUWURRZQVOG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|