C23H29N3O — CID 3279039
2-(2-pentylbenzimidazol-1-yl)-N-phenyl-N-propan-2-ylacetamide (PubChem CID 3279039) has the molecular formula C23H29N3O and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-(2-pentylbenzimidazol-1-yl)-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-(2-pentylbenzimidazol-1-yl)-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 3279039 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-(2-pentylbenzimidazol-1-yl)-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CCCCCc1nc2ccccc2n1CC(=O)N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H29N3O/c1-4-5-7-16-22-24-20-14-10-11-15-21(20)25(22)17-23(27)26(18(2)3)19-12-8-6-9-13-19/h6,8-15,18H,4-5,7,16-17H2,1-3H3 |
| InChIKey | XXBFMEGGIIIOTP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|