C26H35N3O2 — CID 5089305
2-(2-butylbenzimidazol-1-yl)-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 5089305) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-(2-butylbenzimidazol-1-yl)-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-(2-butylbenzimidazol-1-yl)-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 5089305 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-(2-butylbenzimidazol-1-yl)-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | CCCCc1nc2ccccc2n1CC(=O)N(c1c(C)cccc1CC)C(C)COC |
| InChI | InChI=1S/C26H35N3O2/c1-6-8-16-24-27-22-14-9-10-15-23(22)28(24)17-25(30)29(20(4)18-31-5)26-19(3)12-11-13-21(26)7-2/h9-15,20H,6-8,16-18H2,1-5H3 |
| InChIKey | LQDDWDFONUWNGT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |